C15H21FN2O3 — CID 63303231
tert-butyl 3-(4-fluoro-2-methoxyanilino)azetidine-1-carboxylate (PubChem CID 63303231) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is tert-butyl 3-(4-fluoro-2-methoxyanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluoro-2-methoxyanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63303231 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | tert-butyl 3-(4-fluoro-2-methoxyanilino)azetidine-1-carboxylate |
| SMILES | COc1cc(F)ccc1NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H21FN2O3/c1-15(2,3)21-14(19)18-8-11(9-18)17-12-6-5-10(16)7-13(12)20-4/h5-7,11,17H,8-9H2,1-4H3 |
| InChIKey | AYTDNCTWPVOUJP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |