C16H18F3N3O2 — CID 113353594
tert-butyl 3-[2-cyano-4-(trifluoromethyl)anilino]azetidine-1-carboxylate (PubChem CID 113353594) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is tert-butyl 3-[2-cyano-4-(trifluoromethyl)anilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-cyano-4-(trifluoromethyl)anilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 113353594 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 3-[2-cyano-4-(trifluoromethyl)anilino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2ccc(C(F)(F)F)cc2C#N)C1 |
| InChI | InChI=1S/C16H18F3N3O2/c1-15(2,3)24-14(23)22-8-12(9-22)21-13-5-4-11(16(17,18)19)6-10(13)7-20/h4-6,12,21H,8-9H2,1-3H3 |
| InChIKey | LEIMAQQGJHNWJX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |