C10H7F3N2O — CID 67798826
N-[2-cyano-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 67798826) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is N-[2-cyano-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-cyano-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67798826 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N-[2-cyano-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C10H7F3N2O/c1-6(16)15-9-3-2-8(10(11,12)13)4-7(9)5-14/h2-4H,1H3,(H,15,16) |
| InChIKey | VSGXNYZOQBWTIT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |