C13H14F3N3O — CID 115911191
N-[2-cyano-4-(trifluoromethyl)phenyl]-4-(methylamino)butanamide (PubChem CID 115911191) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is N-[2-cyano-4-(trifluoromethyl)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 115911191 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H14F3N3O/c1-18-6-2-3-12(20)19-11-5-4-10(13(14,15)16)7-9(11)8-17/h4-5,7,18H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | XGTQYIKYWULBRA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|