C13H14F6N2O — CID 119672496
N-[3,5-bis(trifluoromethyl)phenyl]-4-(methylamino)butanamide (PubChem CID 119672496) has the molecular formula C13H14F6N2O and a molecular weight of 328.26 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119672496 |
| Molecular Formula | C13H14F6N2O |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6N2O/c1-20-4-2-3-11(22)21-10-6-8(12(14,15)16)5-9(7-10)13(17,18)19/h5-7,20H,2-4H2,1H3,(H,21,22) |
| InChIKey | UUTCURBZVJCBLI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|