C11H12BrF3N2O — CID 65491997
4-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 65491997) has the molecular formula C11H12BrF3N2O and a molecular weight of 325.13 g/mol. Its IUPAC name is 4-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 65491997 |
| Molecular Formula | C11H12BrF3N2O |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | NCCCC(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12BrF3N2O/c12-8-4-7(11(13,14)15)5-9(6-8)17-10(18)2-1-3-16/h4-6H,1-3,16H2,(H,17,18) |
| InChIKey | XFKRSMSZJRAWLJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |