C10H8BrF3N2OS — CID 65491424
3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]-3-sulfanylidenepropanamide (PubChem CID 65491424) has the molecular formula C10H8BrF3N2OS and a molecular weight of 341.15 g/mol. Its IUPAC name is 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 65491424 |
| Molecular Formula | C10H8BrF3N2OS |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8BrF3N2OS/c11-6-1-5(10(12,13)14)2-7(3-6)16-9(17)4-8(15)18/h1-3H,4H2,(H2,15,18)(H,16,17) |
| InChIKey | LLZITNXDPTZFOJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|