C14H10BrF3N2S — CID 115662379
1-[3-bromo-5-(trifluoromethyl)phenyl]-3-phenylthiourea (PubChem CID 115662379) has the molecular formula C14H10BrF3N2S and a molecular weight of 375.21 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-phenylthiourea.
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 115662379 |
| Molecular Formula | C14H10BrF3N2S |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-phenylthiourea |
| SMILES | FC(F)(F)c1cc(Br)cc(NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C14H10BrF3N2S/c15-10-6-9(14(16,17)18)7-12(8-10)20-13(21)19-11-4-2-1-3-5-11/h1-8H,(H2,19,20,21) |
| InChIKey | BRQWIUQIBWXMRF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|