C9H8BrF3N2S — CID 115662372
1-[3-bromo-5-(trifluoromethyl)phenyl]-3-methylthiourea (PubChem CID 115662372) has the molecular formula C9H8BrF3N2S and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-methylthiourea.
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 115662372 |
| Molecular Formula | C9H8BrF3N2S |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8BrF3N2S/c1-14-8(16)15-7-3-5(9(11,12)13)2-6(10)4-7/h2-4H,1H3,(H2,14,15,16) |
| InChIKey | YECKPARCCNDBBZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|