C11H9BrF3NO3 — CID 114898660
3-[3-bromo-5-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898660) has the molecular formula C11H9BrF3NO3 and a molecular weight of 340.10 g/mol. Its IUPAC name is 3-[3-bromo-5-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[3-bromo-5-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114898660 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-[3-bromo-5-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BrF3NO3/c1-5(10(18)19)9(17)16-8-3-6(11(13,14)15)2-7(12)4-8/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZFVRWJNNXNEJQS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|