C11H11BrF3NO2 — CID 103430139
N-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide (PubChem CID 103430139) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is N-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 103430139 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC(C)(O)C(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NO2/c1-10(2,18)9(17)16-8-4-6(11(13,14)15)3-7(12)5-8/h3-5,18H,1-2H3,(H,16,17) |
| InChIKey | QYGTVNOQAMURGN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |