C11H12F3NO2 — CID 71371552
2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 71371552) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 71371552 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)(O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO2/c1-10(2,17)9(16)15-8-5-3-4-7(6-8)11(12,13)14/h3-6,17H,1-2H3,(H,15,16) |
| InChIKey | DOFAKQUGUJXYPV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |