C18H18F3NO4S — CID 3598782
3-benzylsulfonyl-2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 3598782) has the molecular formula C18H18F3NO4S and a molecular weight of 401.41 g/mol. Its IUPAC name is 3-benzylsulfonyl-2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-benzylsulfonyl-2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3598782 |
| Molecular Formula | C18H18F3NO4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-benzylsulfonyl-2-hydroxy-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(O)(CS(=O)(=O)Cc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO4S/c1-17(24,12-27(25,26)11-13-6-3-2-4-7-13)16(23)22-15-9-5-8-14(10-15)18(19,20)21/h2-10,24H,11-12H2,1H3,(H,22,23) |
| InChIKey | IERKEXQSHCCPAG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |