C18H18F3NO — CID 91572023
2-methyl-4-phenyl-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 91572023) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-methyl-4-phenyl-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-methyl-4-phenyl-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 91572023 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-methyl-4-phenyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(CCc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO/c1-13(10-11-14-6-3-2-4-7-14)17(23)22-16-9-5-8-15(12-16)18(19,20)21/h2-9,12-13H,10-11H2,1H3,(H,22,23) |
| InChIKey | VCVFSQKTGVTMQT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |