C12H14F3NOS — CID 167244697
2-methyl-3-sulfanyl-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 167244697) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-methyl-3-sulfanyl-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-methyl-3-sulfanyl-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 167244697 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-methyl-3-sulfanyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(S)C(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NOS/c1-7(8(2)18)11(17)16-10-5-3-4-9(6-10)12(13,14)15/h3-8,18H,1-2H3,(H,16,17) |
| InChIKey | QDJTXUJZFXPJFF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|