C12H15F3N2O — CID 22690700
(2S)-2-amino-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 22690700) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 22690700 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O/c1-7(2)10(16)11(18)17-9-5-3-4-8(6-9)12(13,14)15/h3-7,10H,16H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | KKEPOORBACZIRC-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |