C12H16F3N3O — CID 110481478
2-amino-N-[2-amino-5-(trifluoromethyl)phenyl]-3-methylbutanamide (PubChem CID 110481478) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-amino-N-[2-amino-5-(trifluoromethyl)phenyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[2-amino-5-(trifluoromethyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110481478 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-amino-N-[2-amino-5-(trifluoromethyl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)Nc1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C12H16F3N3O/c1-6(2)10(17)11(19)18-9-5-7(12(13,14)15)3-4-8(9)16/h3-6,10H,16-17H2,1-2H3,(H,18,19) |
| InChIKey | MGCJJGAKTFGNPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|