C13H17F3N2O2 — CID 103930266
(2R)-2-amino-N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 103930266) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103930266 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (2R)-2-amino-N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C13H17F3N2O2/c1-12(2,3)10(17)11(20)18-8-6-7(13(14,15)16)4-5-9(8)19/h4-6,10,19H,17H2,1-3H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | WTDYDEVNGOVAKC-JTQLQIEISA-N |
| XLogP | 2.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|