C22H28N2O4 — CID 10524086
N,N'-bis(5-tert-butyl-2-hydroxyphenyl)oxamide (PubChem CID 10524086) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N,N'-bis(5-tert-butyl-2-hydroxyphenyl)oxamide.
| Compound Name | N,N'-bis(5-tert-butyl-2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 10524086 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N,N'-bis(5-tert-butyl-2-hydroxyphenyl)oxamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)C(=O)Nc2cc(C(C)(C)C)ccc2O)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-21(2,3)13-7-9-17(25)15(11-13)23-19(27)20(28)24-16-12-14(22(4,5)6)8-10-18(16)26/h7-12,25-26H,1-6H3,(H,23,27)(H,24,28) |
| InChIKey | XONWHKYJMDFUKW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|