C19H23NO2 — CID 51573262
N-(5-tert-butyl-2-hydroxyphenyl)-3,4-dimethylbenzamide (PubChem CID 51573262) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-3,4-dimethylbenzamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 51573262 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(C)(C)C)ccc2O)cc1C |
| InChI | InChI=1S/C19H23NO2/c1-12-6-7-14(10-13(12)2)18(22)20-16-11-15(19(3,4)5)8-9-17(16)21/h6-11,21H,1-5H3,(H,20,22) |
| InChIKey | CEUMMTWMYPKOCI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|