C18H18N2O2S — CID 27672924
N-(5-tert-butyl-2-hydroxyphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 27672924) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 27672924 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C18H18N2O2S/c1-18(2,3)12-5-7-15(21)14(9-12)20-17(22)11-4-6-13-16(8-11)23-10-19-13/h4-10,21H,1-3H3,(H,20,22) |
| InChIKey | ANOLVZNLBNTXNL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|