C16H14N2OS — CID 16546690
N-(2,6-dimethylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 16546690) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 16546690 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C16H14N2OS/c1-10-4-3-5-11(2)15(10)18-16(19)12-6-7-13-14(8-12)20-9-17-13/h3-9H,1-2H3,(H,18,19) |
| InChIKey | BLAPUKPNBUAWEM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |