C16H12N2O3S — CID 4797242
methyl 3-(1,3-benzothiazole-6-carbonylamino)benzoate (PubChem CID 4797242) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is methyl 3-(1,3-benzothiazole-6-carbonylamino)benzoate.
| Compound Name | methyl 3-(1,3-benzothiazole-6-carbonylamino)benzoate |
|---|---|
| PubChem CID | 4797242 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | methyl 3-(1,3-benzothiazole-6-carbonylamino)benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C16H12N2O3S/c1-21-16(20)11-3-2-4-12(7-11)18-15(19)10-5-6-13-14(8-10)22-9-17-13/h2-9H,1H3,(H,18,19) |
| InChIKey | RDLDMJHMFSUUOI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |