C15H9N3OS — CID 2092315
N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 2092315) has the molecular formula C15H9N3OS and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 2092315 |
| Molecular Formula | C15H9N3OS |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc3ncsc3c2)cc1 |
| InChI | InChI=1S/C15H9N3OS/c16-8-10-1-4-12(5-2-10)18-15(19)11-3-6-13-14(7-11)20-9-17-13/h1-7,9H,(H,18,19) |
| InChIKey | GJABMIUOOWUERB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |