C20H22N2O3S — CID 24643722
N-(3,4-dipropoxyphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 24643722) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(3,4-dipropoxyphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(3,4-dipropoxyphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 24643722 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(3,4-dipropoxyphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2ccc3ncsc3c2)cc1OCCC |
| InChI | InChI=1S/C20H22N2O3S/c1-3-9-24-17-8-6-15(12-18(17)25-10-4-2)22-20(23)14-5-7-16-19(11-14)26-13-21-16/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,22,23) |
| InChIKey | ILBURGFBKZEKRN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |