C20H24N2O5 — CID 141154638
N-[4-(hydroxycarbamoyl)phenyl]-3,4-dipropoxybenzamide (PubChem CID 141154638) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[4-(hydroxycarbamoyl)phenyl]-3,4-dipropoxybenzamide.
| Compound Name | N-[4-(hydroxycarbamoyl)phenyl]-3,4-dipropoxybenzamide |
|---|---|
| PubChem CID | 141154638 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[4-(hydroxycarbamoyl)phenyl]-3,4-dipropoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2ccc(C(=O)NO)cc2)cc1OCCC |
| InChI | InChI=1S/C20H24N2O5/c1-3-11-26-17-10-7-15(13-18(17)27-12-4-2)19(23)21-16-8-5-14(6-9-16)20(24)22-25/h5-10,13,25H,3-4,11-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | VILFANJRKWQMFH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|