C18H20N2O5 — CID 3276495
3-ethoxy-N-(4-nitrophenyl)-4-propoxybenzamide (PubChem CID 3276495) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-ethoxy-N-(4-nitrophenyl)-4-propoxybenzamide.
| Compound Name | 3-ethoxy-N-(4-nitrophenyl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 3276495 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-ethoxy-N-(4-nitrophenyl)-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1OCC |
| InChI | InChI=1S/C18H20N2O5/c1-3-11-25-16-10-5-13(12-17(16)24-4-2)18(21)19-14-6-8-15(9-7-14)20(22)23/h5-10,12H,3-4,11H2,1-2H3,(H,19,21) |
| InChIKey | JLGLMPMIDBEXTL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|