C25H24N4O7 — CID 126225259
3,4-diethoxy-N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 126225259) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126225259 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3,4-diethoxy-N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(C(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1OCC |
| InChI | InChI=1S/C25H24N4O7/c1-3-35-21-13-10-18(15-22(21)36-4-2)23(30)26-19-7-5-6-17(14-19)25(32)28-27-24(31)16-8-11-20(12-9-16)29(33)34/h5-15H,3-4H2,1-2H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | MUBSACPEVGGCPX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|