C21H19N3O5 — CID 39269336
3-ethoxy-N-(3-nitrophenyl)-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 39269336) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-ethoxy-N-(3-nitrophenyl)-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 3-ethoxy-N-(3-nitrophenyl)-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 39269336 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-ethoxy-N-(3-nitrophenyl)-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc([N+](=O)[O-])c2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C21H19N3O5/c1-2-28-20-11-16(8-9-19(20)29-14-15-5-4-10-22-13-15)21(25)23-17-6-3-7-18(12-17)24(26)27/h3-13H,2,14H2,1H3,(H,23,25) |
| InChIKey | WOXYQGGXIOPCMP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|