C24H25N3O6 — CID 55576480
N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3,4-dimethoxybenzohydrazide (PubChem CID 55576480) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 55576480 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3,4-dimethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(OC)c(OC)c2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C24H25N3O6/c1-4-32-22-13-18(8-10-20(22)33-15-16-6-5-11-25-14-16)24(29)27-26-23(28)17-7-9-19(30-2)21(12-17)31-3/h5-14H,4,15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | PGAIYPJUOKJEDE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|