C24H26N2O5 — CID 46426672
3,4-diethoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide (PubChem CID 46426672) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3,4-diethoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 46426672 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3,4-diethoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(OC)c(OCc3cccnc3)c2)cc1OCC |
| InChI | InChI=1S/C24H26N2O5/c1-4-29-21-10-8-18(13-22(21)30-5-2)24(27)26-19-9-11-20(28-3)23(14-19)31-16-17-7-6-12-25-15-17/h6-15H,4-5,16H2,1-3H3,(H,26,27) |
| InChIKey | MRLISJNENJYOBP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |