C25H27N3O6 — CID 30837646
4-ethoxy-N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3-methoxybenzohydrazide (PubChem CID 30837646) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-ethoxy-N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3-methoxybenzohydrazide.
| Compound Name | 4-ethoxy-N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 30837646 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-ethoxy-N'-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]-3-methoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(OCc3cccnc3)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C25H27N3O6/c1-4-32-20-10-8-18(13-22(20)31-3)24(29)27-28-25(30)19-9-11-21(23(14-19)33-5-2)34-16-17-7-6-12-26-15-17/h6-15H,4-5,16H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | STKTYQFBJCODLR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|