C26H29N3O5 — CID 43058759
N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzohydrazide (PubChem CID 43058759) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 43058759 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)C(C)Oc2cccc(C)c2C)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C26H29N3O5/c1-5-32-24-14-21(11-12-23(24)33-16-20-9-7-13-27-15-20)26(31)29-28-25(30)19(4)34-22-10-6-8-17(2)18(22)3/h6-15,19H,5,16H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | XGSINTHIBYWLPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|