C21H26N2O5 — CID 119363379
(2R)-2-[[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 119363379) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2R)-2-[[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363379 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (2R)-2-[[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CCOc1cc(C(=O)N[C@H](CC(C)C)C(=O)O)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C21H26N2O5/c1-4-27-19-11-16(20(24)23-17(21(25)26)10-14(2)3)7-8-18(19)28-13-15-6-5-9-22-12-15/h5-9,11-12,14,17H,4,10,13H2,1-3H3,(H,23,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | DKWXHQALNRYKTL-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |