C17H25NO5 — CID 119364336
(2R)-2-[(3,4-diethoxybenzoyl)amino]-4-methylpentanoic acid (PubChem CID 119364336) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2R)-2-[(3,4-diethoxybenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(3,4-diethoxybenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364336 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2R)-2-[(3,4-diethoxybenzoyl)amino]-4-methylpentanoic acid |
| SMILES | CCOc1ccc(C(=O)N[C@H](CC(C)C)C(=O)O)cc1OCC |
| InChI | InChI=1S/C17H25NO5/c1-5-22-14-8-7-12(10-15(14)23-6-2)16(19)18-13(17(20)21)9-11(3)4/h7-8,10-11,13H,5-6,9H2,1-4H3,(H,18,19)(H,20,21)/t13-/m1/s1 |
| InChIKey | NKYSQSVSDWTSLO-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |