C15H21NO6 — CID 120702980
2-[(4-ethoxy-3-methoxybenzoyl)amino]-4-methoxybutanoic acid (PubChem CID 120702980) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxybenzoyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(4-ethoxy-3-methoxybenzoyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702980 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxybenzoyl)amino]-4-methoxybutanoic acid |
| SMILES | CCOc1ccc(C(=O)NC(CCOC)C(=O)O)cc1OC |
| InChI | InChI=1S/C15H21NO6/c1-4-22-12-6-5-10(9-13(12)21-3)14(17)16-11(15(18)19)7-8-20-2/h5-6,9,11H,4,7-8H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | CPIWDJGTDBDISA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |