C26H23N5O6S — CID 45020297
3,4-diethoxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide (PubChem CID 45020297) has the molecular formula C26H23N5O6S and a molecular weight of 533.57 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 45020297 |
| Molecular Formula | C26H23N5O6S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 3,4-diethoxy-N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(C(=O)Nc3nnc(-c4ccc([N+](=O)[O-])cc4)s3)c2)cc1OCC |
| InChI | InChI=1S/C26H23N5O6S/c1-3-36-21-13-10-18(15-22(21)37-4-2)23(32)27-19-7-5-6-17(14-19)24(33)28-26-30-29-25(38-26)16-8-11-20(12-9-16)31(34)35/h5-15H,3-4H2,1-2H3,(H,27,32)(H,28,30,33) |
| InChIKey | MBTSGTIEMMBDQJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|