C18H15N5O5S — CID 45009508
ethyl N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]carbamate (PubChem CID 45009508) has the molecular formula C18H15N5O5S and a molecular weight of 413.42 g/mol. Its IUPAC name is ethyl N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 45009508 |
| Molecular Formula | C18H15N5O5S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | ethyl N-[3-[[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)Nc2nnc(-c3ccc([N+](=O)[O-])cc3)s2)c1 |
| InChI | InChI=1S/C18H15N5O5S/c1-2-28-18(25)19-13-5-3-4-12(10-13)15(24)20-17-22-21-16(29-17)11-6-8-14(9-7-11)23(26)27/h3-10H,2H2,1H3,(H,19,25)(H,20,22,24) |
| InChIKey | JLEASIBHXHEPDO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|