C16H12ClN3OS — CID 16813777
N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 16813777) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 16813777 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(-c3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C16H12ClN3OS/c1-10-3-2-4-12(9-10)14(21)18-16-20-19-15(22-16)11-5-7-13(17)8-6-11/h2-9H,1H3,(H,18,20,21) |
| InChIKey | RLPGMEVKMWCLOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |