C16H14N4OS — CID 82176812
N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 82176812) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 82176812 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(-c3cccc(N)c3)s2)c1 |
| InChI | InChI=1S/C16H14N4OS/c1-10-4-2-5-11(8-10)14(21)18-16-20-19-15(22-16)12-6-3-7-13(17)9-12/h2-9H,17H2,1H3,(H,18,20,21) |
| InChIKey | IWUWNMHPQWZDIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|