C12H14N4OS — CID 82105723
N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 82105723) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 82105723 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-[5-(3-aminophenyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C12H14N4OS/c1-7(2)10(17)14-12-16-15-11(18-12)8-4-3-5-9(13)6-8/h3-7H,13H2,1-2H3,(H,14,16,17) |
| InChIKey | PXFCGZQCDCJLMZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|