C11H10ClN3OS — CID 7092310
(2S)-2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 7092310) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is (2S)-2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 7092310 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | (2S)-2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C[C@H](Cl)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C11H10ClN3OS/c1-7(12)9(16)13-11-15-14-10(17-11)8-5-3-2-4-6-8/h2-7H,1H3,(H,13,15,16)/t7-/m0/s1 |
| InChIKey | URBGBDSONZTQIN-ZETCQYMHSA-N |
| XLogP | 2.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|