C19H15ClF2N4O3S — CID 90462881
3-(2-chloropropanoylamino)-4-(difluoromethoxy)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 90462881) has the molecular formula C19H15ClF2N4O3S and a molecular weight of 452.87 g/mol. Its IUPAC name is 3-(2-chloropropanoylamino)-4-(difluoromethoxy)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-(2-chloropropanoylamino)-4-(difluoromethoxy)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 90462881 |
| Molecular Formula | C19H15ClF2N4O3S |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 3-(2-chloropropanoylamino)-4-(difluoromethoxy)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CC(Cl)C(=O)Nc1cc(C(=O)Nc2nnc(-c3ccccc3)s2)ccc1OC(F)F |
| InChI | InChI=1S/C19H15ClF2N4O3S/c1-10(20)15(27)23-13-9-12(7-8-14(13)29-18(21)22)16(28)24-19-26-25-17(30-19)11-5-3-2-4-6-11/h2-10,18H,1H3,(H,23,27)(H,24,26,28) |
| InChIKey | CRXFJLZPPRHDAA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|