C9H9N3S — CID 16763184
3-(5-methyl-1,3,4-thiadiazol-2-yl)aniline (PubChem CID 16763184) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 3-(5-methyl-1,3,4-thiadiazol-2-yl)aniline.
| Compound Name | 3-(5-methyl-1,3,4-thiadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 16763184 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 3-(5-methyl-1,3,4-thiadiazol-2-yl)aniline |
| SMILES | Cc1nnc(-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C9H9N3S/c1-6-11-12-9(13-6)7-3-2-4-8(10)5-7/h2-5H,10H2,1H3 |
| InChIKey | KGKHZNZWEOBBIP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|