C16H13FN2S — CID 114832647
3-[5-(4-fluorophenyl)-4-methyl-1,3-thiazol-2-yl]aniline (PubChem CID 114832647) has the molecular formula C16H13FN2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-4-methyl-1,3-thiazol-2-yl]aniline.
| Compound Name | 3-[5-(4-fluorophenyl)-4-methyl-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 114832647 |
| Molecular Formula | C16H13FN2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-4-methyl-1,3-thiazol-2-yl]aniline |
| SMILES | Cc1nc(-c2cccc(N)c2)sc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2S/c1-10-15(11-5-7-13(17)8-6-11)20-16(19-10)12-3-2-4-14(18)9-12/h2-9H,18H2,1H3 |
| InChIKey | BAQQKLBIQJICLZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|