C16H11F2NS — CID 118149754
2,5-bis(4-fluorophenyl)-4-methyl-1,3-thiazole (PubChem CID 118149754) has the molecular formula C16H11F2NS and a molecular weight of 287.33 g/mol. Its IUPAC name is 2,5-bis(4-fluorophenyl)-4-methyl-1,3-thiazole.
| Compound Name | 2,5-bis(4-fluorophenyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 118149754 |
| Molecular Formula | C16H11F2NS |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2,5-bis(4-fluorophenyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F2NS/c1-10-15(11-2-6-13(17)7-3-11)20-16(19-10)12-4-8-14(18)9-5-12/h2-9H,1H3 |
| InChIKey | CLOAVXILDUAZFY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |