C16H14N2O2S2 — CID 10019555
4-(2-methyl-4-phenyl-1,3-thiazol-5-yl)benzenesulfonamide (PubChem CID 10019555) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-(2-methyl-4-phenyl-1,3-thiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(2-methyl-4-phenyl-1,3-thiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10019555 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-(2-methyl-4-phenyl-1,3-thiazol-5-yl)benzenesulfonamide |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-11-18-15(12-5-3-2-4-6-12)16(21-11)13-7-9-14(10-8-13)22(17,19)20/h2-10H,1H3,(H2,17,19,20) |
| InChIKey | CVPSIMWFHZLLEZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |