C12H10N6O2S — CID 82221255
5-(3-aminophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxylic acid (PubChem CID 82221255) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-(3-aminophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxylic acid.
| Compound Name | 5-(3-aminophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82221255 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-(3-aminophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxylic acid |
| SMILES | Cc1nnc(-n2nnc(C(=O)O)c2-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C12H10N6O2S/c1-6-14-16-12(21-6)18-10(9(11(19)20)15-17-18)7-3-2-4-8(13)5-7/h2-5H,13H2,1H3,(H,19,20) |
| InChIKey | QDKYCTQFNZLDDP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|