C12H8ClN5OS — CID 94962721
5-(3-chlorophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbaldehyde (PubChem CID 94962721) has the molecular formula C12H8ClN5OS and a molecular weight of 305.75 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbaldehyde.
| Compound Name | 5-(3-chlorophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94962721 |
| Molecular Formula | C12H8ClN5OS |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-(3-chlorophenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbaldehyde |
| SMILES | Cc1nnc(-n2nnc(C=O)c2-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C12H8ClN5OS/c1-7-14-16-12(20-7)18-11(10(6-19)15-17-18)8-3-2-4-9(13)5-8/h2-6H,1H3 |
| InChIKey | CYTQRCGGTHGBSF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|