C17H14FN3O — CID 82195707
1-(2,3-dimethylphenyl)-5-(3-fluorophenyl)triazole-4-carbaldehyde (PubChem CID 82195707) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-5-(3-fluorophenyl)triazole-4-carbaldehyde.
| Compound Name | 1-(2,3-dimethylphenyl)-5-(3-fluorophenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82195707 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-5-(3-fluorophenyl)triazole-4-carbaldehyde |
| SMILES | Cc1cccc(-n2nnc(C=O)c2-c2cccc(F)c2)c1C |
| InChI | InChI=1S/C17H14FN3O/c1-11-5-3-8-16(12(11)2)21-17(15(10-22)19-20-21)13-6-4-7-14(18)9-13/h3-10H,1-2H3 |
| InChIKey | GCJFJKXDFHYHQN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|